C11H20ClNO2 — CID 12805591
(2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 12805591) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 12805591 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1C[C@@H](C2CCCCC2)CN1 |
| InChI | InChI=1S/C11H19NO2.ClH/c13-11(14)10-6-9(7-12-10)8-4-2-1-3-5-8;/h8-10,12H,1-7H2,(H,13,14);1H/t9-,10+;/m1./s1 |
| InChIKey | BHGFUQJUTOVQOS-UXQCFNEQSA-N |
| XLogP | 2.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |