About (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury
(5-ethyl-2,4-dioxopyrimidin-1-yl)mercury (PubChem CID 12805649) has the molecular formula C6H7HgN2O2
and a molecular weight of 339.72 g/mol. Its IUPAC name is (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury.
Molecular Properties
| Compound Name | (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury |
| PubChem CID | 12805649 |
| Molecular Formula | C6H7HgN2O2 |
| Molecular Weight | 339.72 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury |
| SMILES | CCc1cn([Hg])c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H8N2O2.Hg/c1-2-4-3-7-6(10)8-5(4)9;/h3H,2H2,1H3,(H2,7,8,9,10);/q;+1/p-1 |
| InChIKey | RBFALNZTTHHNHM-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.72 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury?
The IUPAC name of (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury (CID 12805649) is (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury.
What is the SMILES notation for (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury?
The canonical SMILES for (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury is CCc1cn([Hg])c(=O)[nH]c1=O.
What is the InChIKey of (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury?
The InChIKey is RBFALNZTTHHNHM-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8N2O2.Hg/c1-2-4-3-7-6(10)8-5(4)9;/h3H,2H2,1H3,(H2,7,8,9,10);/q;+1/p-1.
What are the key properties of (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury?
(5-ethyl-2,4-dioxopyrimidin-1-yl)mercury has a molecular weight of 339.72 g/mol, XLogP of -0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2,4-dioxopyrimidin-1-yl)mercury is sourced from PubChem (CID 12805649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).