C19H29NO4 — CID 12805664
9-[3-(dimethylamino)propyl]-1,2,3,4,9,10-hexahydroanthracene-2,3,4a,9a-tetrol (PubChem CID 12805664) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 9-[3-(dimethylamino)propyl]-1,2,3,4,9,10-hexahydroanthracene-2,3,4a,9a-tetrol.
| Compound Name | 9-[3-(dimethylamino)propyl]-1,2,3,4,9,10-hexahydroanthracene-2,3,4a,9a-tetrol |
|---|---|
| PubChem CID | 12805664 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 9-[3-(dimethylamino)propyl]-1,2,3,4,9,10-hexahydroanthracene-2,3,4a,9a-tetrol |
| SMILES | CN(C)CCCC1c2ccccc2CC2(O)CC(O)C(O)CC12O |
| InChI | InChI=1S/C19H29NO4/c1-20(2)9-5-8-15-14-7-4-3-6-13(14)10-18(23)11-16(21)17(22)12-19(15,18)24/h3-4,6-7,15-17,21-24H,5,8-12H2,1-2H3 |
| InChIKey | PJODTZGBERKUIL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |