About 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol
2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol (PubChem CID 12805671) has the molecular formula C15H14O3
and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol |
| PubChem CID | 12805671 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol |
| SMILES | OCCC1Oc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C15H14O3/c16-10-9-13-11-5-1-2-6-12(11)17-14-7-3-4-8-15(14)18-13/h1-8,13,16H,9-10H2 |
| InChIKey | NHLKFDKZEWYLNN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol?
The IUPAC name of 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol (CID 12805671) is 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol.
What is the SMILES notation for 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol?
The canonical SMILES for 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol is OCCC1Oc2ccccc2Oc2ccccc21.
What is the InChIKey of 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol?
The InChIKey is NHLKFDKZEWYLNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c16-10-9-13-11-5-1-2-6-12(11)17-14-7-3-4-8-15(14)18-13/h1-8,13,16H,9-10H2.
What are the key properties of 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol?
2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol has a molecular weight of 242.27 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethanol is sourced from PubChem (CID 12805671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).