About [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane
[2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 12805746) has the molecular formula C12H21N2O5PS
and a molecular weight of 336.35 g/mol. Its IUPAC name is [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 12805746 |
| Molecular Formula | C12H21N2O5PS |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)Oc1cc(COC)nc(COC)n1 |
| InChI | InChI=1S/C12H21N2O5PS/c1-5-17-20(21,18-6-2)19-12-7-10(8-15-3)13-11(14-12)9-16-4/h7H,5-6,8-9H2,1-4H3 |
| InChIKey | JXCFXYPDEPXVFM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane?
The IUPAC name of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane (CID 12805746) is [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane is CCOP(=S)(OCC)Oc1cc(COC)nc(COC)n1.
What is the InChIKey of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane?
The InChIKey is JXCFXYPDEPXVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N2O5PS/c1-5-17-20(21,18-6-2)19-12-7-10(8-15-3)13-11(14-12)9-16-4/h7H,5-6,8-9H2,1-4H3.
What are the key properties of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane?
[2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane has a molecular weight of 336.35 g/mol, XLogP of 2.45, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-diethoxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 12805746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).