About [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane
[2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane (PubChem CID 12805820) has the molecular formula C10H17N2O5PS
and a molecular weight of 308.30 g/mol. Its IUPAC name is [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane.
Molecular Properties
| Compound Name | [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane |
| PubChem CID | 12805820 |
| Molecular Formula | C10H17N2O5PS |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane |
| SMILES | COCc1cc(OP(=S)(OC)OC)nc(COC)n1 |
| InChI | InChI=1S/C10H17N2O5PS/c1-13-6-8-5-10(12-9(11-8)7-14-2)17-18(19,15-3)16-4/h5H,6-7H2,1-4H3 |
| InChIKey | ASGGJKJJXKWTRI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane?
The IUPAC name of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane (CID 12805820) is [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane.
What is the SMILES notation for [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane?
The canonical SMILES for [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane is COCc1cc(OP(=S)(OC)OC)nc(COC)n1.
What is the InChIKey of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane?
The InChIKey is ASGGJKJJXKWTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N2O5PS/c1-13-6-8-5-10(12-9(11-8)7-14-2)17-18(19,15-3)16-4/h5H,6-7H2,1-4H3.
What are the key properties of [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane?
[2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane has a molecular weight of 308.30 g/mol, XLogP of 1.67, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(methoxymethyl)pyrimidin-4-yl]oxy-dimethoxy-sulfanylidene-lambda5-phosphane is sourced from PubChem (CID 12805820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).