C17H21NOS — CID 12805916
(3R,5R)-5-(4-methoxyphenyl)-2,2-dimethyl-3-thiophen-2-ylpyrrolidine (PubChem CID 12805916) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is (3R,5R)-5-(4-methoxyphenyl)-2,2-dimethyl-3-thiophen-2-ylpyrrolidine.
| Compound Name | (3R,5R)-5-(4-methoxyphenyl)-2,2-dimethyl-3-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 12805916 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3R,5R)-5-(4-methoxyphenyl)-2,2-dimethyl-3-thiophen-2-ylpyrrolidine |
| SMILES | COc1ccc([C@H]2C[C@@H](c3cccs3)C(C)(C)N2)cc1 |
| InChI | InChI=1S/C17H21NOS/c1-17(2)14(16-5-4-10-20-16)11-15(18-17)12-6-8-13(19-3)9-7-12/h4-10,14-15,18H,11H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | IOXBBNAZFRKICN-LSDHHAIUSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |