About 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide
5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide (PubChem CID 12806001) has the molecular formula C12H23N7O2S2
and a molecular weight of 361.50 g/mol. Its IUPAC name is 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide.
Molecular Properties
| Compound Name | 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide |
| PubChem CID | 12806001 |
| Molecular Formula | C12H23N7O2S2 |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide |
| SMILES | CCCNS(=O)(=O)/N=C(\N)CCCCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C12H23N7O2S2/c1-2-7-16-23(20,21)19-10(13)6-4-3-5-9-8-22-12(17-9)18-11(14)15/h8,16H,2-7H2,1H3,(H2,13,19)(H4,14,15,17,18) |
| InChIKey | HBCXAVLRBFHMFX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide?
The IUPAC name of 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide (CID 12806001) is 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide.
What is the SMILES notation for 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide?
The canonical SMILES for 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide is CCCNS(=O)(=O)/N=C(\N)CCCCc1csc(N=C(N)N)n1.
What is the InChIKey of 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide?
The InChIKey is HBCXAVLRBFHMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N7O2S2/c1-2-7-16-23(20,21)19-10(13)6-4-3-5-9-8-22-12(17-9)18-11(14)15/h8,16H,2-7H2,1H3,(H2,13,19)(H4,14,15,17,18).
What are the key properties of 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide?
5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide has a molecular weight of 361.50 g/mol, XLogP of 0.36, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N'-(propylsulfamoyl)pentanimidamide is sourced from PubChem (CID 12806001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).