C22H25FN2O8 — CID 12806024
[(2R,3S,5R)-5-[3-(4-butoxybenzoyl)-5-fluoro-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl acetate (PubChem CID 12806024) has the molecular formula C22H25FN2O8 and a molecular weight of 464.45 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[3-(4-butoxybenzoyl)-5-fluoro-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-5-[3-(4-butoxybenzoyl)-5-fluoro-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12806024 |
| Molecular Formula | C22H25FN2O8 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [(2R,3S,5R)-5-[3-(4-butoxybenzoyl)-5-fluoro-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl acetate |
| SMILES | CCCCOc1ccc(C(=O)n2c(=O)c(F)cn([C@H]3C[C@H](O)[C@@H](COC(C)=O)O3)c2=O)cc1 |
| InChI | InChI=1S/C22H25FN2O8/c1-3-4-9-31-15-7-5-14(6-8-15)20(28)25-21(29)16(23)11-24(22(25)30)19-10-17(27)18(33-19)12-32-13(2)26/h5-8,11,17-19,27H,3-4,9-10,12H2,1-2H3/t17-,18+,19+/m0/s1 |
| InChIKey | MPWPHXNXQVXJQX-IPMKNSEASA-N |
| XLogP | 1.23 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|