About methyl 4-acetamidobutanoate
methyl 4-acetamidobutanoate (PubChem CID 12806311) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is methyl 4-acetamidobutanoate.
Molecular Properties
| Compound Name | methyl 4-acetamidobutanoate |
| PubChem CID | 12806311 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | methyl 4-acetamidobutanoate |
| SMILES | COC(=O)CCCNC(C)=O |
| InChI | InChI=1S/C7H13NO3/c1-6(9)8-5-3-4-7(10)11-2/h3-5H2,1-2H3,(H,8,9) |
| InChIKey | WVBYDQHWBZLOAA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-acetamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-acetamidobutanoate?
The IUPAC name of methyl 4-acetamidobutanoate (CID 12806311) is methyl 4-acetamidobutanoate.
What is the SMILES notation for methyl 4-acetamidobutanoate?
The canonical SMILES for methyl 4-acetamidobutanoate is COC(=O)CCCNC(C)=O.
What is the InChIKey of methyl 4-acetamidobutanoate?
The InChIKey is WVBYDQHWBZLOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-6(9)8-5-3-4-7(10)11-2/h3-5H2,1-2H3,(H,8,9).
What are the key properties of methyl 4-acetamidobutanoate?
methyl 4-acetamidobutanoate has a molecular weight of 159.19 g/mol, XLogP of 0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-acetamidobutanoate is sourced from PubChem (CID 12806311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).