C18H27N3O2 — CID 12806675
2,2-dimethyl-8-phenoxy-4-(1,2,4-triazol-1-yl)octan-3-ol (PubChem CID 12806675) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2,2-dimethyl-8-phenoxy-4-(1,2,4-triazol-1-yl)octan-3-ol.
| Compound Name | 2,2-dimethyl-8-phenoxy-4-(1,2,4-triazol-1-yl)octan-3-ol |
|---|---|
| PubChem CID | 12806675 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2,2-dimethyl-8-phenoxy-4-(1,2,4-triazol-1-yl)octan-3-ol |
| SMILES | CC(C)(C)C(O)C(CCCCOc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C18H27N3O2/c1-18(2,3)17(22)16(21-14-19-13-20-21)11-7-8-12-23-15-9-5-4-6-10-15/h4-6,9-10,13-14,16-17,22H,7-8,11-12H2,1-3H3 |
| InChIKey | NGHNNQKBFXDRQT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|