C8H11BrFN3O — CID 12806793
1-bromo-4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one (PubChem CID 12806793) has the molecular formula C8H11BrFN3O and a molecular weight of 264.10 g/mol. Its IUPAC name is 1-bromo-4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one.
| Compound Name | 1-bromo-4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one |
|---|---|
| PubChem CID | 12806793 |
| Molecular Formula | C8H11BrFN3O |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-bromo-4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one |
| SMILES | CC(C)(CF)C(=O)C(Br)n1cncn1 |
| InChI | InChI=1S/C8H11BrFN3O/c1-8(2,3-10)6(14)7(9)13-5-11-4-12-13/h4-5,7H,3H2,1-2H3 |
| InChIKey | DCMHBIVYIXAOBO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|