C14H27N — CID 12807205
(2E)-N,N-diethyl-2,6-dimethylocta-2,7-dien-1-amine (PubChem CID 12807205) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (2E)-N,N-diethyl-2,6-dimethylocta-2,7-dien-1-amine.
| Compound Name | (2E)-N,N-diethyl-2,6-dimethylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 12807205 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (2E)-N,N-diethyl-2,6-dimethylocta-2,7-dien-1-amine |
| SMILES | C=CC(C)CC/C=C(\C)CN(CC)CC |
| InChI | InChI=1S/C14H27N/c1-6-13(4)10-9-11-14(5)12-15(7-2)8-3/h6,11,13H,1,7-10,12H2,2-5H3/b14-11+ |
| InChIKey | DWWXKQADNQHIIE-SDNWHVSQSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|