C15H15Cl2N3O2 — CID 12807338
2,2-dichloro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]cyclopropane-1-carboxamide (PubChem CID 12807338) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 12807338 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2,2-dichloro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)C2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c1-8-6-12(21)19-20-13(8)9-2-4-10(5-3-9)18-14(22)11-7-15(11,16)17/h2-5,8,11H,6-7H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | XLMBHVIHHFBKMO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|