C13H18N4OS — CID 1280738
N'-(azepane-1-carbothioyl)pyridine-4-carbohydrazide (PubChem CID 1280738) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N'-(azepane-1-carbothioyl)pyridine-4-carbohydrazide.
| Compound Name | N'-(azepane-1-carbothioyl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 1280738 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N'-(azepane-1-carbothioyl)pyridine-4-carbohydrazide |
| SMILES | O=C(NNC(=S)N1CCCCCC1)c1ccncc1 |
| InChI | InChI=1S/C13H18N4OS/c18-12(11-5-7-14-8-6-11)15-16-13(19)17-9-3-1-2-4-10-17/h5-8H,1-4,9-10H2,(H,15,18)(H,16,19) |
| InChIKey | PNGRQRKPUAUXLI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|