C20H24ClFN4O — CID 1280805
N'-[(1S)-1-(4-chlorophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetohydrazide (PubChem CID 1280805) has the molecular formula C20H24ClFN4O and a molecular weight of 390.89 g/mol. Its IUPAC name is N'-[(1S)-1-(4-chlorophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetohydrazide.
| Compound Name | N'-[(1S)-1-(4-chlorophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 1280805 |
| Molecular Formula | C20H24ClFN4O |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N'-[(1S)-1-(4-chlorophenyl)ethyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetohydrazide |
| SMILES | C[C@H](NNC(=O)CN1CCN(c2ccc(F)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClFN4O/c1-15(16-2-4-17(21)5-3-16)23-24-20(27)14-25-10-12-26(13-11-25)19-8-6-18(22)7-9-19/h2-9,15,23H,10-14H2,1H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | UYVAMPDFARVXET-HNNXBMFYSA-N |
| XLogP | 2.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|