About (2-methyl-1,3-thiazol-5-yl)methanol
(2-methyl-1,3-thiazol-5-yl)methanol (PubChem CID 12808792) has the molecular formula C5H7NOS
and a molecular weight of 129.18 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-1,3-thiazol-5-yl)methanol |
| PubChem CID | 12808792 |
| Molecular Formula | C5H7NOS |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | (2-methyl-1,3-thiazol-5-yl)methanol |
| SMILES | Cc1ncc(CO)s1 |
| InChI | InChI=1S/C5H7NOS/c1-4-6-2-5(3-7)8-4/h2,7H,3H2,1H3 |
| InChIKey | UGNOVENEUBRGNI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-1,3-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazol-5-yl)methanol?
The IUPAC name of (2-methyl-1,3-thiazol-5-yl)methanol (CID 12808792) is (2-methyl-1,3-thiazol-5-yl)methanol.
What is the SMILES notation for (2-methyl-1,3-thiazol-5-yl)methanol?
The canonical SMILES for (2-methyl-1,3-thiazol-5-yl)methanol is Cc1ncc(CO)s1.
What is the InChIKey of (2-methyl-1,3-thiazol-5-yl)methanol?
The InChIKey is UGNOVENEUBRGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS/c1-4-6-2-5(3-7)8-4/h2,7H,3H2,1H3.
What are the key properties of (2-methyl-1,3-thiazol-5-yl)methanol?
(2-methyl-1,3-thiazol-5-yl)methanol has a molecular weight of 129.18 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazol-5-yl)methanol is sourced from PubChem (CID 12808792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).