About 3-oxo-N-(1,3-thiazol-2-yl)butanamide
3-oxo-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 12811) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 3-oxo-N-(1,3-thiazol-2-yl)butanamide.
Molecular Properties
| Compound Name | 3-oxo-N-(1,3-thiazol-2-yl)butanamide |
| PubChem CID | 12811 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 3-oxo-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC(=O)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H8N2O2S/c1-5(10)4-6(11)9-7-8-2-3-12-7/h2-3H,4H2,1H3,(H,8,9,11) |
| InChIKey | IWMDVLIESVGDLX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-N-(1,3-thiazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-N-(1,3-thiazol-2-yl)butanamide?
The IUPAC name of 3-oxo-N-(1,3-thiazol-2-yl)butanamide (CID 12811) is 3-oxo-N-(1,3-thiazol-2-yl)butanamide.
What is the SMILES notation for 3-oxo-N-(1,3-thiazol-2-yl)butanamide?
The canonical SMILES for 3-oxo-N-(1,3-thiazol-2-yl)butanamide is CC(=O)CC(=O)Nc1nccs1.
What is the InChIKey of 3-oxo-N-(1,3-thiazol-2-yl)butanamide?
The InChIKey is IWMDVLIESVGDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c1-5(10)4-6(11)9-7-8-2-3-12-7/h2-3H,4H2,1H3,(H,8,9,11).
What are the key properties of 3-oxo-N-(1,3-thiazol-2-yl)butanamide?
3-oxo-N-(1,3-thiazol-2-yl)butanamide has a molecular weight of 184.22 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-N-(1,3-thiazol-2-yl)butanamide is sourced from PubChem (CID 12811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).