About 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol
3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol (PubChem CID 12811336) has the molecular formula C16H12N2OS
and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol |
| PubChem CID | 12811336 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol |
| SMILES | Cc1ccc2c(c1)sc1nc(-c3cccc(O)c3)cn12 |
| InChI | InChI=1S/C16H12N2OS/c1-10-5-6-14-15(7-10)20-16-17-13(9-18(14)16)11-3-2-4-12(19)8-11/h2-9,19H,1H3 |
| InChIKey | BWPDPSQXUUZBNX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol?
The IUPAC name of 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol (CID 12811336) is 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol.
What is the SMILES notation for 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol?
The canonical SMILES for 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol is Cc1ccc2c(c1)sc1nc(-c3cccc(O)c3)cn12.
What is the InChIKey of 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol?
The InChIKey is BWPDPSQXUUZBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS/c1-10-5-6-14-15(7-10)20-16-17-13(9-18(14)16)11-3-2-4-12(19)8-11/h2-9,19H,1H3.
What are the key properties of 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol?
3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol has a molecular weight of 280.35 g/mol, XLogP of 4.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methylimidazo[2,1-b][1,3]benzothiazol-2-yl)phenol is sourced from PubChem (CID 12811336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).