1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid

C7H11NO2S2 — CID 12811392

IUPAC1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid
SMILESO=C(O)C1CC2(CN1)SCCS2
InChIInChI=1S/C7H11NO2S2/c9-6(10)5-3-7(4-8-5)11-1-2-12-7/h5,8H,1-4H2,(H,9,10)
InChIKeyPRRCQQGBVXMEKW-UHFFFAOYSA-N
MW205.30 g/mol
LogP0.61
Rot. Bonds1

About 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid

1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 12811392) has the molecular formula C7H11NO2S2 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid.

Molecular Properties

Compound Name1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid
PubChem CID12811392
Molecular FormulaC7H11NO2S2
Molecular Weight205.30 g/mol
Exact Mass205.02
IUPAC Name1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid
SMILESO=C(O)C1CC2(CN1)SCCS2
InChIInChI=1S/C7H11NO2S2/c9-6(10)5-3-7(4-8-5)11-1-2-12-7/h5,8H,1-4H2,(H,9,10)
InChIKeyPRRCQQGBVXMEKW-UHFFFAOYSA-N
XLogP0.61
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.30
LogP ≤ 50.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
The IUPAC name of 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid (CID 12811392) is 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid.
What is the SMILES notation for 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
The canonical SMILES for 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid is O=C(O)C1CC2(CN1)SCCS2.
What is the InChIKey of 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
The InChIKey is PRRCQQGBVXMEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S2/c9-6(10)5-3-7(4-8-5)11-1-2-12-7/h5,8H,1-4H2,(H,9,10).
What are the key properties of 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid has a molecular weight of 205.30 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid is sourced from PubChem (CID 12811392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).