About (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid
(8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 12811394) has the molecular formula C7H11NO2S2
and a molecular weight of 205.30 g/mol. Its IUPAC name is (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid.
Molecular Properties
| Compound Name | (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| PubChem CID | 12811394 |
| Molecular Formula | C7H11NO2S2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC2(CN1)SCCS2 |
| InChI | InChI=1S/C7H11NO2S2/c9-6(10)5-3-7(4-8-5)11-1-2-12-7/h5,8H,1-4H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | PRRCQQGBVXMEKW-YFKPBYRVSA-N |
| XLogP | 0.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
The IUPAC name of (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid (CID 12811394) is (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid.
What is the SMILES notation for (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
The canonical SMILES for (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid is O=C(O)[C@@H]1CC2(CN1)SCCS2.
What is the InChIKey of (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
The InChIKey is PRRCQQGBVXMEKW-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11NO2S2/c9-6(10)5-3-7(4-8-5)11-1-2-12-7/h5,8H,1-4H2,(H,9,10)/t5-/m0/s1.
What are the key properties of (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid?
(8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid has a molecular weight of 205.30 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid is sourced from PubChem (CID 12811394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).