About 2-phenylmethoxyguanidine
2-phenylmethoxyguanidine (PubChem CID 12812) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-phenylmethoxyguanidine.
Molecular Properties
| Compound Name | 2-phenylmethoxyguanidine |
| PubChem CID | 12812 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-phenylmethoxyguanidine |
| SMILES | NC(N)=NOCc1ccccc1 |
| InChI | InChI=1S/C8H11N3O/c9-8(10)11-12-6-7-4-2-1-3-5-7/h1-5H,6H2,(H4,9,10,11) |
| InChIKey | WWHZKHHZRIJLEM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyguanidine?
The IUPAC name of 2-phenylmethoxyguanidine (CID 12812) is 2-phenylmethoxyguanidine.
What is the SMILES notation for 2-phenylmethoxyguanidine?
The canonical SMILES for 2-phenylmethoxyguanidine is NC(N)=NOCc1ccccc1.
What is the InChIKey of 2-phenylmethoxyguanidine?
The InChIKey is WWHZKHHZRIJLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c9-8(10)11-12-6-7-4-2-1-3-5-7/h1-5H,6H2,(H4,9,10,11).
What are the key properties of 2-phenylmethoxyguanidine?
2-phenylmethoxyguanidine has a molecular weight of 165.20 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyguanidine is sourced from PubChem (CID 12812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).