About 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine
3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 12812459) has the molecular formula C13H5ClF6N4O4
and a molecular weight of 430.65 g/mol. Its IUPAC name is 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 12812459 |
| Molecular Formula | C13H5ClF6N4O4 |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H5ClF6N4O4/c14-7-1-6(13(18,19)20)4-21-11(7)22-10-8(23(25)26)2-5(12(15,16)17)3-9(10)24(27)28/h1-4H,(H,21,22) |
| InChIKey | DZBDRIXEAPQRRU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine (CID 12812459) is 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine is O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine?
The InChIKey is DZBDRIXEAPQRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5ClF6N4O4/c14-7-1-6(13(18,19)20)4-21-11(7)22-10-8(23(25)26)2-5(12(15,16)17)3-9(10)24(27)28/h1-4H,(H,21,22).
What are the key properties of 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine?
3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine has a molecular weight of 430.65 g/mol, XLogP of 5.33, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 12812459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).