About 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine
3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 12812483) has the molecular formula C12H5Cl2F3N4O4
and a molecular weight of 397.10 g/mol. Its IUPAC name is 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine |
| PubChem CID | 12812483 |
| Molecular Formula | C12H5Cl2F3N4O4 |
| Molecular Weight | 397.10 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C12H5Cl2F3N4O4/c13-6-3-18-4-7(14)10(6)19-11-8(20(22)23)1-5(12(15,16)17)2-9(11)21(24)25/h1-4H,(H,18,19) |
| InChIKey | IWLXWEIIZSYAGU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.10 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine?
The IUPAC name of 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine (CID 12812483) is 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine.
What is the SMILES notation for 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine?
The canonical SMILES for 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine is O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1c(Cl)cncc1Cl.
What is the InChIKey of 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine?
The InChIKey is IWLXWEIIZSYAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl2F3N4O4/c13-6-3-18-4-7(14)10(6)19-11-8(20(22)23)1-5(12(15,16)17)2-9(11)21(24)25/h1-4H,(H,18,19).
What are the key properties of 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine?
3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine has a molecular weight of 397.10 g/mol, XLogP of 4.97, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]pyridin-4-amine is sourced from PubChem (CID 12812483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).