About 3-phenoxyazetidine
3-phenoxyazetidine (PubChem CID 12812501) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-phenoxyazetidine.
Molecular Properties
| Compound Name | 3-phenoxyazetidine |
| PubChem CID | 12812501 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-phenoxyazetidine |
| SMILES | c1ccc(OC2CNC2)cc1 |
| InChI | InChI=1S/C9H11NO/c1-2-4-8(5-3-1)11-9-6-10-7-9/h1-5,9-10H,6-7H2 |
| InChIKey | CCDAHKDEKOTDGR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenoxyazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxyazetidine?
The IUPAC name of 3-phenoxyazetidine (CID 12812501) is 3-phenoxyazetidine.
What is the SMILES notation for 3-phenoxyazetidine?
The canonical SMILES for 3-phenoxyazetidine is c1ccc(OC2CNC2)cc1.
What is the InChIKey of 3-phenoxyazetidine?
The InChIKey is CCDAHKDEKOTDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-4-8(5-3-1)11-9-6-10-7-9/h1-5,9-10H,6-7H2.
What are the key properties of 3-phenoxyazetidine?
3-phenoxyazetidine has a molecular weight of 149.19 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxyazetidine is sourced from PubChem (CID 12812501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).