C14H18Br2ClNO — CID 12812535
N-[2,3-bis(bromomethyl)-6-tert-butylphenyl]-2-chloroacetamide (PubChem CID 12812535) has the molecular formula C14H18Br2ClNO and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[2,3-bis(bromomethyl)-6-tert-butylphenyl]-2-chloroacetamide.
| Compound Name | N-[2,3-bis(bromomethyl)-6-tert-butylphenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 12812535 |
| Molecular Formula | C14H18Br2ClNO |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | N-[2,3-bis(bromomethyl)-6-tert-butylphenyl]-2-chloroacetamide |
| SMILES | CC(C)(C)c1ccc(CBr)c(CBr)c1NC(=O)CCl |
| InChI | InChI=1S/C14H18Br2ClNO/c1-14(2,3)11-5-4-9(6-15)10(7-16)13(11)18-12(19)8-17/h4-5H,6-8H2,1-3H3,(H,18,19) |
| InChIKey | FTYDKCTWIFPABL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|