About (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate
(9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate (PubChem CID 12813220) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate.
Molecular Properties
| Compound Name | (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate |
| PubChem CID | 12813220 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate |
| SMILES | CCCC1(C)OCC2(CCC1OC(C)=O)OCCO2 |
| InChI | InChI=1S/C14H24O5/c1-4-6-13(3)12(19-11(2)15)5-7-14(10-18-13)16-8-9-17-14/h12H,4-10H2,1-3H3 |
| InChIKey | KURVSBZKFYQZGT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate?
The IUPAC name of (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate (CID 12813220) is (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate.
What is the SMILES notation for (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate?
The canonical SMILES for (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate is CCCC1(C)OCC2(CCC1OC(C)=O)OCCO2.
What is the InChIKey of (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate?
The InChIKey is KURVSBZKFYQZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c1-4-6-13(3)12(19-11(2)15)5-7-14(10-18-13)16-8-9-17-14/h12H,4-10H2,1-3H3.
What are the key properties of (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate?
(9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate has a molecular weight of 272.34 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-9-propyl-1,4,10-trioxaspiro[4.6]undecan-8-yl) acetate is sourced from PubChem (CID 12813220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).