C12H20O — CID 12813408
(2E)-3,4,4,7-tetramethylocta-2,6-dienal (PubChem CID 12813408) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E)-3,4,4,7-tetramethylocta-2,6-dienal.
| Compound Name | (2E)-3,4,4,7-tetramethylocta-2,6-dienal |
|---|---|
| PubChem CID | 12813408 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2E)-3,4,4,7-tetramethylocta-2,6-dienal |
| SMILES | CC(C)=CCC(C)(C)/C(C)=C/C=O |
| InChI | InChI=1S/C12H20O/c1-10(2)6-8-12(4,5)11(3)7-9-13/h6-7,9H,8H2,1-5H3/b11-7+ |
| InChIKey | YPSUYSMTKJCUTO-YRNVUSSQSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|