C10H9Cl2F5O — CID 12814280
3-[(Z)-2-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 12814280) has the molecular formula C10H9Cl2F5O and a molecular weight of 311.08 g/mol. Its IUPAC name is 3-[(Z)-2-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | 3-[(Z)-2-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 12814280 |
| Molecular Formula | C10H9Cl2F5O |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 3-[(Z)-2-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(/C=C(\Cl)C(F)(F)C(F)(F)F)C1C(=O)Cl |
| InChI | InChI=1S/C10H9Cl2F5O/c1-8(2)4(6(8)7(12)18)3-5(11)9(13,14)10(15,16)17/h3-4,6H,1-2H3/b5-3- |
| InChIKey | VFEPNPDYERZKHB-HYXAFXHYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|