C28H24O2 — CID 12815412
(E)-1,1,4,4-tetraphenylbut-2-ene-1,4-diol (PubChem CID 12815412) has the molecular formula C28H24O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (E)-1,1,4,4-tetraphenylbut-2-ene-1,4-diol.
| Compound Name | (E)-1,1,4,4-tetraphenylbut-2-ene-1,4-diol |
|---|---|
| PubChem CID | 12815412 |
| Molecular Formula | C28H24O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (E)-1,1,4,4-tetraphenylbut-2-ene-1,4-diol |
| SMILES | OC(/C=C/C(O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24O2/c29-27(23-13-5-1-6-14-23,24-15-7-2-8-16-24)21-22-28(30,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22,29-30H/b22-21+ |
| InChIKey | XECWCIGULVRDKS-QURGRASLSA-N |
| XLogP | 5.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|