About 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane
2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane (PubChem CID 12815897) has the molecular formula C8H18O6S
and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane |
| PubChem CID | 12815897 |
| Molecular Formula | C8H18O6S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane |
| SMILES | COC(CS(=O)(=O)CC(OC)OC)OC |
| InChI | InChI=1S/C8H18O6S/c1-11-7(12-2)5-15(9,10)6-8(13-3)14-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | VCMBFBUXKPEPLM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane?
The IUPAC name of 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane (CID 12815897) is 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane.
What is the SMILES notation for 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane?
The canonical SMILES for 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane is COC(CS(=O)(=O)CC(OC)OC)OC.
What is the InChIKey of 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane?
The InChIKey is VCMBFBUXKPEPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O6S/c1-11-7(12-2)5-15(9,10)6-8(13-3)14-4/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane?
2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane has a molecular weight of 242.29 g/mol, XLogP of -0.36, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethylsulfonyl)-1,1-dimethoxyethane is sourced from PubChem (CID 12815897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).