About 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole
1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole (PubChem CID 12816469) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole.
Molecular Properties
| Compound Name | 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
| PubChem CID | 12816469 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
| SMILES | c1ccc(CCC2(Cn3ccnc3)OCCO2)cc1 |
| InChI | InChI=1S/C15H18N2O2/c1-2-4-14(5-3-1)6-7-15(18-10-11-19-15)12-17-9-8-16-13-17/h1-5,8-9,13H,6-7,10-12H2 |
| InChIKey | GKXREDWUTLNBPG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole?
The IUPAC name of 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole (CID 12816469) is 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole.
What is the SMILES notation for 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole?
The canonical SMILES for 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole is c1ccc(CCC2(Cn3ccnc3)OCCO2)cc1.
What is the InChIKey of 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole?
The InChIKey is GKXREDWUTLNBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-2-4-14(5-3-1)6-7-15(18-10-11-19-15)12-17-9-8-16-13-17/h1-5,8-9,13H,6-7,10-12H2.
What are the key properties of 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole?
1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole has a molecular weight of 258.32 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methyl]imidazole is sourced from PubChem (CID 12816469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).