C6H10O3 — CID 12816776
(2R,3S,4S)-2-methyl-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 12816776) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (2R,3S,4S)-2-methyl-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2R,3S,4S)-2-methyl-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 12816776 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2R,3S,4S)-2-methyl-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | C[C@H]1OC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O3/c1-4-6(8)5(7)2-3-9-4/h2-8H,1H3/t4-,5+,6-/m1/s1 |
| InChIKey | ZPKHLHZFXAQVMQ-NGJCXOISSA-N |
| XLogP | -0.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |