C18H32O5Si — CID 12816909
ethyl (2E)-2-[(3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]acetate (PubChem CID 12816909) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is ethyl (2E)-2-[(3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]acetate |
|---|---|
| PubChem CID | 12816909 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethyl (2E)-2-[(3aR,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H32O5Si/c1-7-21-17(20)9-12-8-13-14(15(19)10-16(13)23-12)11-22-24(5,6)18(2,3)4/h9,13-16,19H,7-8,10-11H2,1-6H3/b12-9+/t13-,14-,15-,16+/m1/s1 |
| InChIKey | OXTGUACOJIYPON-KKMCVXANSA-N |
| XLogP | 3.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|