About 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide
4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide (PubChem CID 12816992) has the molecular formula C10H9Cl2N5OS
and a molecular weight of 318.19 g/mol. Its IUPAC name is 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide |
| PubChem CID | 12816992 |
| Molecular Formula | C10H9Cl2N5OS |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(c2nc(Cl)nc3c(Cl)ncnc23)CC1 |
| InChI | InChI=1S/C10H9Cl2N5OS/c11-8-6-7(13-5-14-8)9(16-10(12)15-6)17-1-3-19(18)4-2-17/h5H,1-4H2 |
| InChIKey | BDSJKAHYJFOELO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide?
The IUPAC name of 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide (CID 12816992) is 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide.
What is the SMILES notation for 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide?
The canonical SMILES for 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide is O=S1CCN(c2nc(Cl)nc3c(Cl)ncnc23)CC1.
What is the InChIKey of 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide?
The InChIKey is BDSJKAHYJFOELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2N5OS/c11-8-6-7(13-5-14-8)9(16-10(12)15-6)17-1-3-19(18)4-2-17/h5H,1-4H2.
What are the key properties of 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide?
4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide has a molecular weight of 318.19 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,8-dichloropyrimido[5,4-d]pyrimidin-4-yl)-1,4-thiazinane 1-oxide is sourced from PubChem (CID 12816992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).