About 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione
8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 12817) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
Molecular Properties
| Compound Name | 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| PubChem CID | 12817 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C9H14N2O2/c1-6-2-4-9(5-3-6)7(12)10-8(13)11-9/h6H,2-5H2,1H3,(H2,10,11,12,13) |
| InChIKey | YDHFGMUUNFASMP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The IUPAC name of 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (CID 12817) is 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
What is the SMILES notation for 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The canonical SMILES for 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione is CC1CCC2(CC1)NC(=O)NC2=O.
What is the InChIKey of 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The InChIKey is YDHFGMUUNFASMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6-2-4-9(5-3-6)7(12)10-8(13)11-9/h6H,2-5H2,1H3,(H2,10,11,12,13).
What are the key properties of 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione?
8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione has a molecular weight of 182.22 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione is sourced from PubChem (CID 12817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).