About 4-bromo-N,N-dimethylbenzenesulfonamide
4-bromo-N,N-dimethylbenzenesulfonamide (PubChem CID 12818) has the molecular formula C8H10BrNO2S
and a molecular weight of 264.14 g/mol. Its IUPAC name is 4-bromo-N,N-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-bromo-N,N-dimethylbenzenesulfonamide |
| PubChem CID | 12818 |
| Molecular Formula | C8H10BrNO2S |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 4-bromo-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H10BrNO2S/c1-10(2)13(11,12)8-5-3-7(9)4-6-8/h3-6H,1-2H3 |
| InChIKey | NQAUNPZZVCXYEJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N,N-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-dimethylbenzenesulfonamide?
The IUPAC name of 4-bromo-N,N-dimethylbenzenesulfonamide (CID 12818) is 4-bromo-N,N-dimethylbenzenesulfonamide.
What is the SMILES notation for 4-bromo-N,N-dimethylbenzenesulfonamide?
The canonical SMILES for 4-bromo-N,N-dimethylbenzenesulfonamide is CN(C)S(=O)(=O)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N,N-dimethylbenzenesulfonamide?
The InChIKey is NQAUNPZZVCXYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO2S/c1-10(2)13(11,12)8-5-3-7(9)4-6-8/h3-6H,1-2H3.
What are the key properties of 4-bromo-N,N-dimethylbenzenesulfonamide?
4-bromo-N,N-dimethylbenzenesulfonamide has a molecular weight of 264.14 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-dimethylbenzenesulfonamide is sourced from PubChem (CID 12818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).