C18H30O3 — CID 1281811
(4aR,6aR,10aS,10bR)-spiro[1,2,3,4,6a,7,8,9,10,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane]-4a,10a-diol (PubChem CID 1281811) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (4aR,6aR,10aS,10bR)-spiro[1,2,3,4,6a,7,8,9,10,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane]-4a,10a-diol.
| Compound Name | (4aR,6aR,10aS,10bR)-spiro[1,2,3,4,6a,7,8,9,10,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane]-4a,10a-diol |
|---|---|
| PubChem CID | 1281811 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4aR,6aR,10aS,10bR)-spiro[1,2,3,4,6a,7,8,9,10,10b-decahydrobenzo[c]chromene-6,1'-cyclohexane]-4a,10a-diol |
| SMILES | O[C@@]12CCCC[C@H]1C1(CCCCC1)O[C@]1(O)CCCC[C@H]21 |
| InChI | InChI=1S/C18H30O3/c19-17-12-6-2-8-14(17)16(10-4-1-5-11-16)21-18(20)13-7-3-9-15(17)18/h14-15,19-20H,1-13H2/t14-,15+,17-,18+/m0/s1 |
| InChIKey | GATCEJCAKDSFNO-CIRFHOKZSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |