About N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide
N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide (PubChem CID 12818265) has the molecular formula C16H24ClNO3
and a molecular weight of 313.83 g/mol. Its IUPAC name is N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide.
Molecular Properties
| Compound Name | N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide |
| PubChem CID | 12818265 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide |
| SMILES | COCc1ccc(C(C)(C)C)c(NC(=O)CCl)c1COC |
| InChI | InChI=1S/C16H24ClNO3/c1-16(2,3)13-7-6-11(9-20-4)12(10-21-5)15(13)18-14(19)8-17/h6-7H,8-10H2,1-5H3,(H,18,19) |
| InChIKey | JYGMDNSBRDCATO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide?
The IUPAC name of N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide (CID 12818265) is N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide.
What is the SMILES notation for N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide?
The canonical SMILES for N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide is COCc1ccc(C(C)(C)C)c(NC(=O)CCl)c1COC.
What is the InChIKey of N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide?
The InChIKey is JYGMDNSBRDCATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClNO3/c1-16(2,3)13-7-6-11(9-20-4)12(10-21-5)15(13)18-14(19)8-17/h6-7H,8-10H2,1-5H3,(H,18,19).
What are the key properties of N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide?
N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide has a molecular weight of 313.83 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-tert-butyl-2,3-bis(methoxymethyl)phenyl]-2-chloroacetamide is sourced from PubChem (CID 12818265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).