C22H20O6 — CID 12819113
9-acetyl-9-hydroxy-6,11-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 12819113) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is 9-acetyl-9-hydroxy-6,11-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 9-acetyl-9-hydroxy-6,11-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 12819113 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 9-acetyl-9-hydroxy-6,11-dimethoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1c2c(c(OC)c3c1C(=O)c1ccccc1C3=O)CC(O)(C(C)=O)CC2 |
| InChI | InChI=1S/C22H20O6/c1-11(23)22(26)9-8-14-15(10-22)21(28-3)17-16(20(14)27-2)18(24)12-6-4-5-7-13(12)19(17)25/h4-7,26H,8-10H2,1-3H3 |
| InChIKey | KOTIZSPABVYPJX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|