C15H15F3N4O8S2 — CID 12819686
2,2,2-trifluoroethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]benzenesulfonate (PubChem CID 12819686) has the molecular formula C15H15F3N4O8S2 and a molecular weight of 500.43 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]benzenesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 12819686 |
| Molecular Formula | C15H15F3N4O8S2 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]benzenesulfonate |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2ccccc2S(=O)(=O)OCC(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F3N4O8S2/c1-28-11-7-12(29-2)20-13(19-11)21-14(23)22-31(24,25)9-5-3-4-6-10(9)32(26,27)30-8-15(16,17)18/h3-7H,8H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | DFJSCEXGDWKZES-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|