About 3-(decylamino)propane-1,2-diol
3-(decylamino)propane-1,2-diol (PubChem CID 12820574) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is 3-(decylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(decylamino)propane-1,2-diol |
| PubChem CID | 12820574 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 3-(decylamino)propane-1,2-diol |
| SMILES | CCCCCCCCCCNCC(O)CO |
| InChI | InChI=1S/C13H29NO2/c1-2-3-4-5-6-7-8-9-10-14-11-13(16)12-15/h13-16H,2-12H2,1H3 |
| InChIKey | UIEJEXBQVZLMGC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(decylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(decylamino)propane-1,2-diol?
The IUPAC name of 3-(decylamino)propane-1,2-diol (CID 12820574) is 3-(decylamino)propane-1,2-diol.
What is the SMILES notation for 3-(decylamino)propane-1,2-diol?
The canonical SMILES for 3-(decylamino)propane-1,2-diol is CCCCCCCCCCNCC(O)CO.
What is the InChIKey of 3-(decylamino)propane-1,2-diol?
The InChIKey is UIEJEXBQVZLMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO2/c1-2-3-4-5-6-7-8-9-10-14-11-13(16)12-15/h13-16H,2-12H2,1H3.
What are the key properties of 3-(decylamino)propane-1,2-diol?
3-(decylamino)propane-1,2-diol has a molecular weight of 231.38 g/mol, XLogP of 2.07, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(decylamino)propane-1,2-diol is sourced from PubChem (CID 12820574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).