C9H11N3S — CID 12820932
N,2,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 12820932) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is N,2,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N,2,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 12820932 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N,2,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(C)nc2sc(C)cc12 |
| InChI | InChI=1S/C9H11N3S/c1-5-4-7-8(10-3)11-6(2)12-9(7)13-5/h4H,1-3H3,(H,10,11,12) |
| InChIKey | GJIGFVQJZLYIJL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |