About (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid
(2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 12821147) has the molecular formula C11H19NO5S
and a molecular weight of 277.34 g/mol. Its IUPAC name is (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 12821147 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | COC1(OC)C[C@@H](C(=O)O)N(C(=O)C(C)CS)C1 |
| InChI | InChI=1S/C11H19NO5S/c1-7(5-18)9(13)12-6-11(16-2,17-3)4-8(12)10(14)15/h7-8,18H,4-6H2,1-3H3,(H,14,15)/t7?,8-/m0/s1 |
| InChIKey | HGJZUVHTFSPDPZ-MQWKRIRWSA-N |
| XLogP | 0.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid (CID 12821147) is (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid is COC1(OC)C[C@@H](C(=O)O)N(C(=O)C(C)CS)C1.
What is the InChIKey of (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid?
The InChIKey is HGJZUVHTFSPDPZ-MQWKRIRWSA-N. The full InChI is InChI=1S/C11H19NO5S/c1-7(5-18)9(13)12-6-11(16-2,17-3)4-8(12)10(14)15/h7-8,18H,4-6H2,1-3H3,(H,14,15)/t7?,8-/m0/s1.
What are the key properties of (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid?
(2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid has a molecular weight of 277.34 g/mol, XLogP of 0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-dimethoxy-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 12821147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).