About (5-chloro-2-oxopentyl) benzenesulfonate
(5-chloro-2-oxopentyl) benzenesulfonate (PubChem CID 12821734) has the molecular formula C11H13ClO4S
and a molecular weight of 276.74 g/mol. Its IUPAC name is (5-chloro-2-oxopentyl) benzenesulfonate.
Molecular Properties
| Compound Name | (5-chloro-2-oxopentyl) benzenesulfonate |
| PubChem CID | 12821734 |
| Molecular Formula | C11H13ClO4S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (5-chloro-2-oxopentyl) benzenesulfonate |
| SMILES | O=C(CCCCl)COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13ClO4S/c12-8-4-5-10(13)9-16-17(14,15)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | BERFBHZEPBHRQB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2-oxopentyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-oxopentyl) benzenesulfonate?
The IUPAC name of (5-chloro-2-oxopentyl) benzenesulfonate (CID 12821734) is (5-chloro-2-oxopentyl) benzenesulfonate.
What is the SMILES notation for (5-chloro-2-oxopentyl) benzenesulfonate?
The canonical SMILES for (5-chloro-2-oxopentyl) benzenesulfonate is O=C(CCCCl)COS(=O)(=O)c1ccccc1.
What is the InChIKey of (5-chloro-2-oxopentyl) benzenesulfonate?
The InChIKey is BERFBHZEPBHRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO4S/c12-8-4-5-10(13)9-16-17(14,15)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2.
What are the key properties of (5-chloro-2-oxopentyl) benzenesulfonate?
(5-chloro-2-oxopentyl) benzenesulfonate has a molecular weight of 276.74 g/mol, XLogP of 1.98, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-oxopentyl) benzenesulfonate is sourced from PubChem (CID 12821734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).