About 2-phenyl-3,4-dihydro-2H-chromen-3-amine
2-phenyl-3,4-dihydro-2H-chromen-3-amine (PubChem CID 12822974) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-phenyl-3,4-dihydro-2H-chromen-3-amine.
Molecular Properties
| Compound Name | 2-phenyl-3,4-dihydro-2H-chromen-3-amine |
| PubChem CID | 12822974 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-phenyl-3,4-dihydro-2H-chromen-3-amine |
| SMILES | NC1Cc2ccccc2OC1c1ccccc1 |
| InChI | InChI=1S/C15H15NO/c16-13-10-12-8-4-5-9-14(12)17-15(13)11-6-2-1-3-7-11/h1-9,13,15H,10,16H2 |
| InChIKey | SEGCIDDNDLLTAW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-3,4-dihydro-2H-chromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3,4-dihydro-2H-chromen-3-amine?
The IUPAC name of 2-phenyl-3,4-dihydro-2H-chromen-3-amine (CID 12822974) is 2-phenyl-3,4-dihydro-2H-chromen-3-amine.
What is the SMILES notation for 2-phenyl-3,4-dihydro-2H-chromen-3-amine?
The canonical SMILES for 2-phenyl-3,4-dihydro-2H-chromen-3-amine is NC1Cc2ccccc2OC1c1ccccc1.
What is the InChIKey of 2-phenyl-3,4-dihydro-2H-chromen-3-amine?
The InChIKey is SEGCIDDNDLLTAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c16-13-10-12-8-4-5-9-14(12)17-15(13)11-6-2-1-3-7-11/h1-9,13,15H,10,16H2.
What are the key properties of 2-phenyl-3,4-dihydro-2H-chromen-3-amine?
2-phenyl-3,4-dihydro-2H-chromen-3-amine has a molecular weight of 225.29 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3,4-dihydro-2H-chromen-3-amine is sourced from PubChem (CID 12822974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).