About 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione
2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione (PubChem CID 1282325) has the molecular formula C21H15Cl3N2O3
and a molecular weight of 449.72 g/mol. Its IUPAC name is 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione |
| PubChem CID | 1282325 |
| Molecular Formula | C21H15Cl3N2O3 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(N2CCN(C(=O)c3ccc(Cl)c(Cl)c3)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H15Cl3N2O3/c22-15-6-5-12(11-16(15)23)21(29)26-9-7-25(8-10-26)18-17(24)19(27)13-3-1-2-4-14(13)20(18)28/h1-6,11H,7-10H2 |
| InChIKey | YGTBHUADNHDETB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione?
The IUPAC name of 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione (CID 1282325) is 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione.
What is the SMILES notation for 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione?
The canonical SMILES for 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione is O=C1C(Cl)=C(N2CCN(C(=O)c3ccc(Cl)c(Cl)c3)CC2)C(=O)c2ccccc21.
What is the InChIKey of 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione?
The InChIKey is YGTBHUADNHDETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl3N2O3/c22-15-6-5-12(11-16(15)23)21(29)26-9-7-25(8-10-26)18-17(24)19(27)13-3-1-2-4-14(13)20(18)28/h1-6,11H,7-10H2.
What are the key properties of 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione?
2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione has a molecular weight of 449.72 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]naphthalene-1,4-dione is sourced from PubChem (CID 1282325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).