C5H7ClN2 — CID 12823254
4-chloro-1,3-dimethylpyrazole (PubChem CID 12823254) has the molecular formula C5H7ClN2 and a molecular weight of 130.58 g/mol. Its IUPAC name is 4-chloro-1,3-dimethylpyrazole.
| Compound Name | 4-chloro-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 12823254 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 4-chloro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)cc1Cl |
| InChI | InChI=1S/C5H7ClN2/c1-4-5(6)3-8(2)7-4/h3H,1-2H3 |
| InChIKey | OILOPOQPXXGBIR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |