C16H17N5O2 — CID 12823339
(9E)-6-methyl-4-oxo-9-(phenylhydrazinylidene)-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 12823339) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is (9E)-6-methyl-4-oxo-9-(phenylhydrazinylidene)-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | (9E)-6-methyl-4-oxo-9-(phenylhydrazinylidene)-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 12823339 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (9E)-6-methyl-4-oxo-9-(phenylhydrazinylidene)-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CC1CC/C(=N\Nc2ccccc2)c2ncc(C(N)=O)c(=O)n21 |
| InChI | InChI=1S/C16H17N5O2/c1-10-7-8-13(20-19-11-5-3-2-4-6-11)15-18-9-12(14(17)22)16(23)21(10)15/h2-6,9-10,19H,7-8H2,1H3,(H2,17,22)/b20-13+ |
| InChIKey | PSRIXNKSRSLTAO-DEDYPNTBSA-N |
| XLogP | 1.51 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|