C13H20O3 — CID 12823834
1-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)butane-1,3-dione (PubChem CID 12823834) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)butane-1,3-dione.
| Compound Name | 1-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 12823834 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)C1=C(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C13H20O3/c1-8-5-10(15)7-13(3,4)12(8)11(16)6-9(2)14/h10,15H,5-7H2,1-4H3 |
| InChIKey | YXFUZWMZCJEIRZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|